cas: 331717-63-6 — see every product listed under this CAS number, including other names
1-Ethyl-3-methylimidazolium thiocyanate, ≥97-<99% (CAS 331717-63-6) is a chemical reagent available from Chemat. Available pack sizes: 300g, 400g, 500g, 600g, 700g, 800g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC566-97-99-300g |
| cas | 331717-63-6 |
| size | 300g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 300g | 4289.12 Pln | |
| Hoffman Fine Chemicals | 400g | 4818.66 Pln | |
| Hoffman Fine Chemicals | 500g | 5386.48 Pln | |
| Hoffman Fine Chemicals | 600g | 5788.42 Pln | |
| Hoffman Fine Chemicals | 700g | 6388.14 Pln | |
| Hoffman Fine Chemicals | 800g | 6911.30 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
1-ethyl-3-methylimidazol-3-ium thiocyanate (CAS 331717-63-6) is a chemical compound with the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. IUPAC name: 1-ethyl-3-methylimidazol-3-ium thiocyanate. InChIKey: VASPYXGQVWPGAB-UHFFFAOYSA-M.
| Molecular formula | C7H11N3S |
|---|---|
| Molecular weight | 169.25 g/mol |
| IUPAC name | 1-ethyl-3-methylimidazol-3-ium thiocyanate |
| InChIKey | VASPYXGQVWPGAB-UHFFFAOYSA-M |
| SMILES | CCN1C=C[N+](=C1)C.C(#N)[S-] |
Computed by PubChem (NCBI)