cas: 124170-06-5 — see every product listed under this CAS number, including other names
1-Fluoro-2-nitro-4-(trifluoromethoxy)benzene 98% (CAS 124170-06-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A298590-1g |
| cas | 124170-06-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 353.69 Pln | |
| Ambeed | 25g | 1176.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A298590 |
1-fluoro-2-nitro-4-(trifluoromethoxy)benzene (CAS 124170-06-5) is a chemical compound with the molecular formula C7H3F4NO3 and a molecular weight of 225.10 g/mol. IUPAC name: 1-fluoro-2-nitro-4-(trifluoromethoxy)benzene. InChIKey: XWFNBCCMBGKMFB-UHFFFAOYSA-N.
| Molecular formula | C7H3F4NO3 |
|---|---|
| Molecular weight | 225.10 g/mol |
| IUPAC name | 1-fluoro-2-nitro-4-(trifluoromethoxy)benzene |
| InChIKey | XWFNBCCMBGKMFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)