cas: 81577-08-4 — see every product listed under this CAS number, including other names
1-Fluoro-3-(2,2,2-trifluoroethyl)benzene (CAS 81577-08-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F037196-1G |
| cas | 81577-08-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 726.85 Pln | |
| Fluorochem | 5g | 2132.60 Pln | |
| Fluorochem | 10g | 3486.29 Pln |
| delivery time | 2-3 weeks |
|---|
1-fluoro-3-(2,2,2-trifluoroethyl)benzene (CAS 81577-08-4) is a chemical compound with the molecular formula C8H6F4 and a molecular weight of 178.13 g/mol. IUPAC name: 1-fluoro-3-(2,2,2-trifluoroethyl)benzene. InChIKey: XEMUQSFXYQZZSO-UHFFFAOYSA-N.
| Molecular formula | C8H6F4 |
|---|---|
| Molecular weight | 178.13 g/mol |
| IUPAC name | 1-fluoro-3-(2,2,2-trifluoroethyl)benzene |
| InChIKey | XEMUQSFXYQZZSO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CC(F)(F)F |
Computed by PubChem (NCBI)