1-Isopropyl 4-methyl cubane-1,4-dicarboxylate, 97%
cas: 2901099-45-2 — see every product listed under this CAS number, including other names
1-Isopropyl 4-methyl cubane-1,4-dicarboxylate, 97% (CAS 2901099-45-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1538752-100mg |
| cas | 2901099-45-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 787.56 Pln | |
| Ambeed | 250mg | 1243.69 Pln | |
| Ambeed | 1g | 3340.75 Pln | |
| Ambeed | 5g | 13141.88 Pln | |
| BLDpharm | 100mg | 775.31 Pln | |
| BLDpharm | 250mg | 1225.15 Pln | |
| BLDpharm | 1g | 3274.43 Pln | |
| BLDpharm | 5g | 12882.16 Pln | |
| Chemat | 100mg | 554.00 Pln | |
| Chemat | 250mg | 899.60 Pln | |
| Chemat | 1g | 2315.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1-O-methyl 4-O-propan-2-yl cubane-1,4-dicarboxylate (CAS 2901099-45-2) is a chemical compound with the molecular formula C14H16O4 and a molecular weight of 248.27 g/mol. IUPAC name: 1-O-methyl 4-O-propan-2-yl cubane-1,4-dicarboxylate. InChIKey: SVXQSABSWDTTOH-UHFFFAOYSA-N.
| Molecular formula | C14H16O4 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | 1-O-methyl 4-O-propan-2-yl cubane-1,4-dicarboxylate |
| InChIKey | SVXQSABSWDTTOH-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C12C3C4C1C5C2C3C45C(=O)OC |
Computed by PubChem (NCBI)