Products 2901099-45-2
CAS 2901099-45-2 is the registry number for 1-Isopropyl 4-methyl cubane-1,4-dicarboxylate, 97%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-O-methyl 4-O-propan-2-yl cubane-1,4-dicarboxylate (CAS 2901099-45-2) is a chemical compound with the molecular formula C14H16O4 and a molecular weight of 248.27 g/mol. IUPAC name: 1-O-methyl 4-O-propan-2-yl cubane-1,4-dicarboxylate. InChIKey: SVXQSABSWDTTOH-UHFFFAOYSA-N.
| Molecular formula | C14H16O4 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | 1-O-methyl 4-O-propan-2-yl cubane-1,4-dicarboxylate |
| InChIKey | SVXQSABSWDTTOH-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C12C3C4C1C5C2C3C45C(=O)OC |
Computed by PubChem (NCBI)