Products 51510-78-2

CAS 51510-78-2 is the registry number for Dimethyl 5,6,7,8-tetrahydronaphthalene-2,3-dicarboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Dimethyl 5,6,7,8-tetrahydronaphthalene-2,3-dicarboxylate (CAS 51510-78-2) is a chemical compound with the molecular formula C14H16O4 and a molecular weight of 248.27 g/mol. IUPAC name: dimethyl 5,6,7,8-tetrahydronaphthalene-2,3-dicarboxylate. InChIKey: YWRPARVPYFLULV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H16O4
Molecular weight248.27 g/mol
IUPAC namedimethyl 5,6,7,8-tetrahydronaphthalene-2,3-dicarboxylate
InChIKeyYWRPARVPYFLULV-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C2CCCCC2=C1)C(=O)OC

Computed by PubChem (NCBI)