CAS 190064-28-9 appears in our catalog under these names: 5-(3,4-Dimethoxyphenyl)cyclohexane-1,3-dione, 97%, 5-(3,4-Dimethoxyphenyl)cyclohexane-1,3-dione, 5-(3,4-Dimethoxyphenyl)cyclohexane-1,3-dione, 98%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g, 250mg, 500mg.
5-(3,4-dimethoxyphenyl)cyclohexane-1,3-dione (CAS 190064-28-9) is a chemical compound with the molecular formula C14H16O4 and a molecular weight of 248.27 g/mol. IUPAC name: 5-(3,4-dimethoxyphenyl)cyclohexane-1,3-dione. InChIKey: IRKIDJHFWYGNFG-UHFFFAOYSA-N.
| Molecular formula | C14H16O4 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | 5-(3,4-dimethoxyphenyl)cyclohexane-1,3-dione |
| InChIKey | IRKIDJHFWYGNFG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2CC(=O)CC(=O)C2)OC |
Computed by PubChem (NCBI)