cas: 32795-85-0 — see every product listed under this CAS number, including other names
1-Methoxy-2-(4-nitrophenoxy)benzene, 97%, 97% (CAS 32795-85-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D1Z7-100mg |
| cas | 32795-85-0 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 5g | 1134.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-methoxy-2-(4-nitrophenoxy)benzene (CAS 32795-85-0) is a chemical compound with the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. IUPAC name: 1-methoxy-2-(4-nitrophenoxy)benzene. InChIKey: OOSBNKMKKNIQAN-UHFFFAOYSA-N.
| Molecular formula | C13H11NO4 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 1-methoxy-2-(4-nitrophenoxy)benzene |
| InChIKey | OOSBNKMKKNIQAN-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)