CAS 194093-31-7 appears in our catalog under these names: Methyl (2e)-4-(1,3-dioxo-1,3-dihydro-2h-isoindol-2-yl)but-2-enoate, 95%, (E)–methyl 4–(1,3–dioxoisoindolin–2–yl)but–2–enoate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Methyl (E)-4-(1,3-dioxoisoindol-2-yl)but-2-enoate (CAS 194093-31-7) is a chemical compound with the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. IUPAC name: methyl (E)-4-(1,3-dioxoisoindol-2-yl)but-2-enoate. InChIKey: LLDZOOUNGYCZSH-QPJJXVBHSA-N.
| Molecular formula | C13H11NO4 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | methyl (E)-4-(1,3-dioxoisoindol-2-yl)but-2-enoate |
| InChIKey | LLDZOOUNGYCZSH-QPJJXVBHSA-N |
| SMILES | COC(=O)/C=C/CN1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)