CAS 1225733-94-7 appears in our catalog under these names: 5-(2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)-1h-pyrrole-2-carboxylic acid, 95%, 5–(2,3–Dihydrobenzo(b)(1,4)dioxin–6–yl)–1H–pyrrole–2–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 5g, 1g, 250mg.
5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrrole-2-carboxylic acid (CAS 1225733-94-7) is a chemical compound with the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. IUPAC name: 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrrole-2-carboxylic acid. InChIKey: CMTQCJIGLRISFA-UHFFFAOYSA-N.
| Molecular formula | C13H11NO4 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-pyrrole-2-carboxylic acid |
| InChIKey | CMTQCJIGLRISFA-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C3=CC=C(N3)C(=O)O |
Computed by PubChem (NCBI)