CAS 948294-45-9 appears in our catalog under these names: 6,7-Dimethylquinoline-2,3-dicarboxylic acid, 95%, 6,7-Dimethylquinoline-2,3-dicarboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
6,7-dimethylquinoline-2,3-dicarboxylic acid (CAS 948294-45-9) is a chemical compound with the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. IUPAC name: 6,7-dimethylquinoline-2,3-dicarboxylic acid. InChIKey: JGAHTWZHTMWMSG-UHFFFAOYSA-N.
| Molecular formula | C13H11NO4 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 6,7-dimethylquinoline-2,3-dicarboxylic acid |
| InChIKey | JGAHTWZHTMWMSG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC(=C(N=C2C=C1C)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)