CAS 17758-39-3 is the registry number for 1-Methyl-5-nitropyrimidin-2(1H)-one, 95%. Offered by: Ambeed. Available pack sizes: 50mg.
1-methyl-5-nitropyrimidin-2-one (CAS 17758-39-3) is a chemical compound with the molecular formula C5H5N3O3 and a molecular weight of 155.11 g/mol. IUPAC name: 1-methyl-5-nitropyrimidin-2-one. InChIKey: KYADSVHQTVFLDG-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O3 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 1-methyl-5-nitropyrimidin-2-one |
| InChIKey | KYADSVHQTVFLDG-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=NC1=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)