Products 773108-85-3
CAS 773108-85-3 appears in our catalog under these names: 5-Carbamoyl-1H-imidazole-4-carboxylic acid, 95%, 5-Carbamoyl-1H-imidazole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 25g, 2,5g.
4-carbamoyl-1H-imidazole-5-carboxylic acid (CAS 773108-85-3) is a chemical compound with the molecular formula C5H5N3O3 and a molecular weight of 155.11 g/mol. IUPAC name: 4-carbamoyl-1H-imidazole-5-carboxylic acid. InChIKey: QUQAUBVKOVPUQO-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O3 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 4-carbamoyl-1H-imidazole-5-carboxylic acid |
| InChIKey | QUQAUBVKOVPUQO-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(N1)C(=O)O)C(=O)N |
Computed by PubChem (NCBI)