CAS 1394306-92-3 is the registry number for (2Z)-3-(5-Hydroxy-1h-1,2,4-triazol-3-yl)acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(Z)-3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)prop-2-enoic acid (CAS 1394306-92-3) is a chemical compound with the molecular formula C5H5N3O3 and a molecular weight of 155.11 g/mol. IUPAC name: (Z)-3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)prop-2-enoic acid. InChIKey: KVHXGAAKITUNCJ-UPHRSURJSA-N.
| Molecular formula | C5H5N3O3 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | (Z)-3-(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)prop-2-enoic acid |
| InChIKey | KVHXGAAKITUNCJ-UPHRSURJSA-N |
| SMILES | C(=C\C(=O)O)\C1=NNC(=O)N1 |
Computed by PubChem (NCBI)