Products 64182-15-6
CAS 64182-15-6 appears in our catalog under these names: 1-Methyl-3-nitro-1H-pyrazole-4-carbaldehyde, 97%, 1-Methyl-3-nitro-1H-pyrazole-4-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-methyl-3-nitropyrazole-4-carbaldehyde (CAS 64182-15-6) is a chemical compound with the molecular formula C5H5N3O3 and a molecular weight of 155.11 g/mol. IUPAC name: 1-methyl-3-nitropyrazole-4-carbaldehyde. InChIKey: VFXVYWIXNOIWPK-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O3 |
|---|---|
| Molecular weight | 155.11 g/mol |
| IUPAC name | 1-methyl-3-nitropyrazole-4-carbaldehyde |
| InChIKey | VFXVYWIXNOIWPK-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)