CAS 1443380-07-1 appears in our catalog under these names: 1-Methylindole-7-boronic acid, 95%, 1-Methylindole-7-boronic acid, 95%, 95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg.
(1-methylindol-7-yl)boronic acid (CAS 1443380-07-1) is a chemical compound with the molecular formula C9H10BNO2 and a molecular weight of 174.99 g/mol. IUPAC name: (1-methylindol-7-yl)boronic acid. InChIKey: QDSZQBBGYYIBAE-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO2 |
|---|---|
| Molecular weight | 174.99 g/mol |
| IUPAC name | (1-methylindol-7-yl)boronic acid |
| InChIKey | QDSZQBBGYYIBAE-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)C=CN2C)(O)O |
Computed by PubChem (NCBI)