cas: 67074-71-9 — see every product listed under this CAS number, including other names
1-Methylpyrido[2,3-b]pyrazine-2,3(1H,4H)-dione 97% (CAS 67074-71-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A259021-100mg |
| cas | 67074-71-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 681.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A259021 |
1-methyl-4H-pyrido[2,3-b]pyrazine-2,3-dione (CAS 67074-71-9) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 1-methyl-4H-pyrido[2,3-b]pyrazine-2,3-dione. InChIKey: BSQBDLZRKDSFOK-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 1-methyl-4H-pyrido[2,3-b]pyrazine-2,3-dione |
| InChIKey | BSQBDLZRKDSFOK-UHFFFAOYSA-N |
| SMILES | CN1C2=C(NC(=O)C1=O)N=CC=C2 |
Computed by PubChem (NCBI)