CAS 6942-46-7 appears in our catalog under these names: 1-Phenyl-1,2,4-triazolidine-3,5-dione, 95%, 1-Phenylurazole, 95%, 1-Phenyl-1,2,4-triazolidine-3,5-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1-phenyl-1,2,4-triazolidine-3,5-dione (CAS 6942-46-7) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 1-phenyl-1,2,4-triazolidine-3,5-dione. InChIKey: WFYLHMAYBQLBEM-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 1-phenyl-1,2,4-triazolidine-3,5-dione |
| InChIKey | WFYLHMAYBQLBEM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)