cas: 672310-11-1 — see every product listed under this CAS number, including other names
1-N-Fmoc-3-Piperidone, 96% (CAS 672310-11-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011733-25G |
| cas | 672310-11-1 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 4610.89 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 1216.26 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
9H-fluoren-9-ylmethyl 3-oxopiperidine-1-carboxylate (CAS 672310-11-1) is a chemical compound with the molecular formula C20H19NO3 and a molecular weight of 321.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl 3-oxopiperidine-1-carboxylate. InChIKey: ZHMRQZFSADRNCI-UHFFFAOYSA-N.
| Molecular formula | C20H19NO3 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl 3-oxopiperidine-1-carboxylate |
| InChIKey | ZHMRQZFSADRNCI-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CN(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)