Products 1353016-67-7

CAS 1353016-67-7 is the registry number for 4-(6H-Dibenzo[b,f]azocin-5-yl)-4-oxo-butyric acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 4-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-4-oxobutanoate (CAS 1353016-67-7) is a chemical compound with the molecular formula C20H19NO3 and a molecular weight of 321.4 g/mol. IUPAC name: methyl 4-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-4-oxobutanoate. InChIKey: FMRAIORSWRUSMC-KHPPLWFESA-N.

Identity
Molecular formulaC20H19NO3
Molecular weight321.4 g/mol
IUPAC namemethyl 4-[(11Z)-6H-benzo[c][1]benzazocin-5-yl]-4-oxobutanoate
InChIKeyFMRAIORSWRUSMC-KHPPLWFESA-N
SMILESCOC(=O)CCC(=O)N1CC2=CC=CC=C2/C=C\C3=CC=CC=C31

Computed by PubChem (NCBI)