Products 438230-44-5
CAS 438230-44-5 appears in our catalog under these names: 2-(4-Ethoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid, 95%, 2-(4-Ethoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(4-ethoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid (CAS 438230-44-5) is a chemical compound with the molecular formula C20H19NO3 and a molecular weight of 321.4 g/mol. IUPAC name: 2-(4-ethoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid. InChIKey: HDZCHAZXWZNVBF-UHFFFAOYSA-N.
| Molecular formula | C20H19NO3 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 2-(4-ethoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid |
| InChIKey | HDZCHAZXWZNVBF-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C2=NC3=C(C=C(C=C3C(=C2)C(=O)O)C)C |
Computed by PubChem (NCBI)