CAS 438217-48-2 appears in our catalog under these names: 6-Methyl-2-(4-propoxyphenyl)quinoline-4-carboxylic acid, 95%, 6-Methyl-2-(4-propoxyphenyl)quinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-methyl-2-(4-propoxyphenyl)quinoline-4-carboxylic acid (CAS 438217-48-2) is a chemical compound with the molecular formula C20H19NO3 and a molecular weight of 321.4 g/mol. IUPAC name: 6-methyl-2-(4-propoxyphenyl)quinoline-4-carboxylic acid. InChIKey: QBSBOBRIDZZUBW-UHFFFAOYSA-N.
| Molecular formula | C20H19NO3 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 6-methyl-2-(4-propoxyphenyl)quinoline-4-carboxylic acid |
| InChIKey | QBSBOBRIDZZUBW-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC=C(C=C1)C2=NC3=C(C=C(C=C3)C)C(=C2)C(=O)O |
Computed by PubChem (NCBI)