cas: 2243-56-3 — see every product listed under this CAS number, including other names
1-Naphthylhydrazine hydrochloride, 97% (CAS 2243-56-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F159700-1G |
| cas | 2243-56-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 195.78 Pln | |
| Fluorochem | 10g | 320.74 Pln | |
| Fluorochem | 25g | 695.61 Pln | |
| Fluorochem | 100g | 2174.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Naphthalen-1-ylhydrazine;hydrochloride (CAS 2243-56-3) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: naphthalen-1-ylhydrazine;hydrochloride. InChIKey: FYSSYOCJFZSKNW-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | naphthalen-1-ylhydrazine;hydrochloride |
| InChIKey | FYSSYOCJFZSKNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2NN.Cl |
Computed by PubChem (NCBI)