CAS 3764-94-1 is the registry number for 5-Chlorotryptamine, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
2-(5-chloro-1H-indol-3-yl)ethanamine (CAS 3764-94-1) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: 2-(5-chloro-1H-indol-3-yl)ethanamine. InChIKey: FVQKQPVVCKOWLM-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 2-(5-chloro-1H-indol-3-yl)ethanamine |
| InChIKey | FVQKQPVVCKOWLM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CN2)CCN |
Computed by PubChem (NCBI)