cas: 1644-88-8 — see every product listed under this CAS number, including other names
1-Nitro-2-(trifluoromethoxy)benzene, 98%, 98% (CAS 1644-88-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112UVS-1g |
| cas | 1644-88-8 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 100g | 395.60 Pln | |
| Chemat | 500g | 1488.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-nitro-2-(trifluoromethoxy)benzene (CAS 1644-88-8) is a chemical compound with the molecular formula C7H4F3NO3 and a molecular weight of 207.11 g/mol. IUPAC name: 1-nitro-2-(trifluoromethoxy)benzene. InChIKey: YTWBYJAWWKTPOV-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO3 |
|---|---|
| Molecular weight | 207.11 g/mol |
| IUPAC name | 1-nitro-2-(trifluoromethoxy)benzene |
| InChIKey | YTWBYJAWWKTPOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])OC(F)(F)F |
Computed by PubChem (NCBI)