cas: 1956354-47-4 — see every product listed under this CAS number, including other names
1-Oxa-7-azaspiro[4.5]Decane hemioxalate, 97% (CAS 1956354-47-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch131948-100mg |
| cas | 1956354-47-4 |
| size | 100mg |
| availability | 3g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 866.00 Pln | |
| Chemat | 250mg | 1446.80 Pln | |
| Chemat | 1g | 3165.20 Pln | |
| Fluorochem | 100mg | 1273.53 Pln | |
| Fluorochem | 250mg | 2137.81 Pln | |
| Fluorochem | 1g | 4673.37 Pln | |
| Fluorochem | 5g | 13097.49 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Bis(1-oxa-9-azaspiro[4.5]decane);oxalic acid (CAS 1956354-47-4) is a chemical compound with the molecular formula C18H32N2O6 and a molecular weight of 372.5 g/mol. IUPAC name: bis(1-oxa-9-azaspiro[4.5]decane);oxalic acid. InChIKey: BVHMOEIIPISRBH-UHFFFAOYSA-N.
| Molecular formula | C18H32N2O6 |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | bis(1-oxa-9-azaspiro[4.5]decane);oxalic acid |
| InChIKey | BVHMOEIIPISRBH-UHFFFAOYSA-N |
| SMILES | C1CC2(CCCO2)CNC1.C1CC2(CCCO2)CNC1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)