cas: 61890-25-3 — see every product listed under this CAS number, including other names
1-Phenyl-2-(pyridin-2-yl)ethanamine, 99.63%, 99.63% (CAS 61890-25-3) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EJIY-5mg |
| cas | 61890-25-3 |
| size | 5mg |
| availability | 0.05g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 414.80 Pln | |
| Chemat | 10mg | 616.40 Pln | |
| Chemat | 50mg | 1562.00 Pln |
| purity | 99.63% |
|---|---|
| delivery time | 3 weeks |
1-phenyl-2-pyridin-2-ylethanamine (CAS 61890-25-3) is a chemical compound with the molecular formula C13H14N2 and a molecular weight of 198.26 g/mol. IUPAC name: 1-phenyl-2-pyridin-2-ylethanamine. InChIKey: FWUQWDCOOWEXRY-UHFFFAOYSA-N.
| Molecular formula | C13H14N2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 1-phenyl-2-pyridin-2-ylethanamine |
| InChIKey | FWUQWDCOOWEXRY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC2=CC=CC=N2)N |
Computed by PubChem (NCBI)