cas: 61890-25-3 — see every product listed under this CAS number, including other names
(Rac)-Lanicemine, 99.63% (CAS 61890-25-3) is a chemical reagent available from Chemat. Available pack sizes: 50 mg, 10mM/1mL, 10 mg, 5 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-108235B-50 mg |
| cas | 61890-25-3 |
| size | 50 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 mg | 793.38 Pln | |
| MedChemExpress | 10mM/1mL | 384.71 Pln | |
| MedChemExpress | 10 mg | 361.49 Pln | |
| MedChemExpress | 5 mg | 273.25 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.63% |
1-phenyl-2-pyridin-2-ylethanamine (CAS 61890-25-3) is a chemical compound with the molecular formula C13H14N2 and a molecular weight of 198.26 g/mol. IUPAC name: 1-phenyl-2-pyridin-2-ylethanamine. InChIKey: FWUQWDCOOWEXRY-UHFFFAOYSA-N.
| Molecular formula | C13H14N2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 1-phenyl-2-pyridin-2-ylethanamine |
| InChIKey | FWUQWDCOOWEXRY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC2=CC=CC=N2)N |
Computed by PubChem (NCBI)