cas: 1002334-12-4 — see every product listed under this CAS number, including other names
1-Phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 95% (CAS 1002334-12-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F079594-250MG |
| cas | 1002334-12-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 500mg | 268.67 Pln | |
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 758.08 Pln | |
| Fluorochem | 10g | 1419.31 Pln | |
| Fluorochem | 25g | 2814.65 Pln | |
| Fluorochem | 100g | 10296.39 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1002334-12-4) is a chemical compound with the molecular formula C15H19BN2O2 and a molecular weight of 270.14 g/mol. IUPAC name: 1-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: XPAJFLOIPDXRRD-UHFFFAOYSA-N.
| Molecular formula | C15H19BN2O2 |
|---|---|
| Molecular weight | 270.14 g/mol |
| IUPAC name | 1-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | XPAJFLOIPDXRRD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)