cas: 1002334-12-4 — see every product listed under this CAS number, including other names
1-Phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole, 97%, 97% (CAS 1002334-12-4) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1112AL-50g |
| cas | 1002334-12-4 |
| size | 50g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 4470.80 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 10g | 957.20 Pln | |
| Chemat | 25g | 2301.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 1002334-12-4) is a chemical compound with the molecular formula C15H19BN2O2 and a molecular weight of 270.14 g/mol. IUPAC name: 1-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: XPAJFLOIPDXRRD-UHFFFAOYSA-N.
| Molecular formula | C15H19BN2O2 |
|---|---|
| Molecular weight | 270.14 g/mol |
| IUPAC name | 1-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | XPAJFLOIPDXRRD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)