1-Phenylpiperidine-4-carboxylic acid hydrochloride, 95%
cas: 209005-67-4 — see every product listed under this CAS number, including other names
1-Phenylpiperidine-4-carboxylic acid hydrochloride, 95% (CAS 209005-67-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A141346-100mg |
| cas | 209005-67-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 621.20 Pln | |
| BLDpharm | 100mg | 147.75 Pln | |
| BLDpharm | 250mg | 236.61 Pln | |
| BLDpharm | 1g | 553.16 Pln | |
| Fluorochem | 100mg | 242.64 Pln | |
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 1g | 1143.37 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-phenylpiperidine-4-carboxylic acid;hydrochloride (CAS 209005-67-4) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: 1-phenylpiperidine-4-carboxylic acid;hydrochloride. InChIKey: BEFZAPQHSZCXRM-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | 1-phenylpiperidine-4-carboxylic acid;hydrochloride |
| InChIKey | BEFZAPQHSZCXRM-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)
Synonyms:
1-Phenylpiperidine-4-carboxylic acid--hydrogen chloride (1/1), 1-Phenylpiperidine-4-carboxylic acid hydrochloride, 1-phenylpiperidine-4-carboxylic acid;hydrochloride, 1-Phenylpiperidine-4-carboxylic acid HCl, 4-Piperidinecarboxylic acid, 1-phenyl-, hy, 1-Phenylpiperidine-4-carboxylicacidhydrochloride, phenyl-piperidine-4 carboxylic acid hydrochloride