cas: 911634-75-8 — see every product listed under this CAS number, including other names
1-Piperidinecarboxylic acid, 3,3-difluoro-, 1,1-dimethylethyl ester, 98%, 98% (CAS 911634-75-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IKL6-50mg |
| cas | 911634-75-8 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 174.80 Pln | |
| Chemat | 1g | 539.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3,3-difluoropiperidine-1-carboxylate (CAS 911634-75-8) is a chemical compound with the molecular formula C10H17F2NO2 and a molecular weight of 221.24 g/mol. IUPAC name: tert-butyl 3,3-difluoropiperidine-1-carboxylate. InChIKey: LBDWLNLSKQNMGW-UHFFFAOYSA-N.
| Molecular formula | C10H17F2NO2 |
|---|---|
| Molecular weight | 221.24 g/mol |
| IUPAC name | tert-butyl 3,3-difluoropiperidine-1-carboxylate |
| InChIKey | LBDWLNLSKQNMGW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)(F)F |
Computed by PubChem (NCBI)