Products 1889794-96-0

CAS 1889794-96-0 is the registry number for 3-(4,4-Difluoropiperidin-1-yl)-2,2-dimethylpropionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropanoic acid (CAS 1889794-96-0) is a chemical compound with the molecular formula C10H17F2NO2 and a molecular weight of 221.24 g/mol. IUPAC name: 3-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropanoic acid. InChIKey: VCVDAONUYWZJQL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17F2NO2
Molecular weight221.24 g/mol
IUPAC name3-(4,4-difluoropiperidin-1-yl)-2,2-dimethylpropanoic acid
InChIKeyVCVDAONUYWZJQL-UHFFFAOYSA-N
SMILESCC(C)(CN1CCC(CC1)(F)F)C(=O)O

Computed by PubChem (NCBI)