Products 1896964-16-1

CAS 1896964-16-1 is the registry number for 4-(4,4-Difluoro-piperidin-1-yl)-butyric acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-(4,4-difluoropiperidin-1-yl)butanoate (CAS 1896964-16-1) is a chemical compound with the molecular formula C10H17F2NO2 and a molecular weight of 221.24 g/mol. IUPAC name: methyl 4-(4,4-difluoropiperidin-1-yl)butanoate. InChIKey: YZSSVDMFZXLYFV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H17F2NO2
Molecular weight221.24 g/mol
IUPAC namemethyl 4-(4,4-difluoropiperidin-1-yl)butanoate
InChIKeyYZSSVDMFZXLYFV-UHFFFAOYSA-N
SMILESCOC(=O)CCCN1CCC(CC1)(F)F

Computed by PubChem (NCBI)