CAS 2378490-02-7 is the registry number for Ethyl (1R,5R)-5-amino-4,4-difluorocycloheptane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-ethyl (1R,5R)-5-amino-4,4-difluorocycloheptane-1-carboxylate (CAS 2378490-02-7) is a chemical compound with the molecular formula C10H17F2NO2 and a molecular weight of 221.24 g/mol. IUPAC name: trans-ethyl (1R,5R)-5-amino-4,4-difluorocycloheptane-1-carboxylate. InChIKey: JUYYIIUDOYDHFC-HTQZYQBOSA-N.
| Molecular formula | C10H17F2NO2 |
|---|---|
| Molecular weight | 221.24 g/mol |
| IUPAC name | trans-ethyl (1R,5R)-5-amino-4,4-difluorocycloheptane-1-carboxylate |
| InChIKey | JUYYIIUDOYDHFC-HTQZYQBOSA-N |
| SMILES | CCOC(=O)[C@@H]1CC[C@H](C(CC1)(F)F)N |
Computed by PubChem (NCBI)