cas: 41042-12-0 — see every product listed under this CAS number, including other names
1-Propyl-1H-indole-2,3-dione, 95%, 95% (CAS 41042-12-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CAI5-100mg |
| cas | 41042-12-0 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 362.00 Pln | |
| Chemat | 250mg | 515.60 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 3664.40 Pln | |
| Chemat | 10g | 6174.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-propylindole-2,3-dione (CAS 41042-12-0) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 1-propylindole-2,3-dione. InChIKey: SSUNBCWMOHUMAX-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 1-propylindole-2,3-dione |
| InChIKey | SSUNBCWMOHUMAX-UHFFFAOYSA-N |
| SMILES | CCCN1C2=CC=CC=C2C(=O)C1=O |
Computed by PubChem (NCBI)