cas: 3443-45-6 — see every product listed under this CAS number, including other names
1-Pyrenebutyric acid 95% (CAS 3443-45-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A571530-1g |
| cas | 3443-45-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 10g | 620.69 Pln | |
| Ambeed | 25g | 1171.38 Pln | |
| Ambeed | 100g | 3841.38 Pln | |
| Ambeed | 500g | 15155.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A571530 |
4-pyren-1-ylbutanoic acid (CAS 3443-45-6) is a chemical compound with the molecular formula C20H16O2 and a molecular weight of 288.3 g/mol. IUPAC name: 4-pyren-1-ylbutanoic acid. InChIKey: QXYRRCOJHNZVDJ-UHFFFAOYSA-N.
| Molecular formula | C20H16O2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 4-pyren-1-ylbutanoic acid |
| InChIKey | QXYRRCOJHNZVDJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CCCC(=O)O |
Computed by PubChem (NCBI)