cas: 3443-45-6 — see every product listed under this CAS number, including other names
1-Pyrenebutyric acid, 97+% (CAS 3443-45-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 418510010 |
| cas | 3443-45-6 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 281.08 Pln | |
| Thermo Scientific (Acros) | 5g | 944.34 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97+% |
4-pyren-1-ylbutanoic acid (CAS 3443-45-6) is a chemical compound with the molecular formula C20H16O2 and a molecular weight of 288.3 g/mol. IUPAC name: 4-pyren-1-ylbutanoic acid. InChIKey: QXYRRCOJHNZVDJ-UHFFFAOYSA-N.
| Molecular formula | C20H16O2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 4-pyren-1-ylbutanoic acid |
| InChIKey | QXYRRCOJHNZVDJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CCCC(=O)O |
Computed by PubChem (NCBI)