cas: 3443-45-6 — see every product listed under this CAS number, including other names
1-Pyrenylbutyric acid, 97%, 97% (CAS 3443-45-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140UR-250mg |
| cas | 3443-45-6 |
| size | 250mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 10g | 256.40 Pln | |
| Chemat | 25g | 554.00 Pln | |
| Chemat | 100g | 2022.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-pyren-1-ylbutanoic acid (CAS 3443-45-6) is a chemical compound with the molecular formula C20H16O2 and a molecular weight of 288.3 g/mol. IUPAC name: 4-pyren-1-ylbutanoic acid. InChIKey: QXYRRCOJHNZVDJ-UHFFFAOYSA-N.
| Molecular formula | C20H16O2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 4-pyren-1-ylbutanoic acid |
| InChIKey | QXYRRCOJHNZVDJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CCCC(=O)O |
Computed by PubChem (NCBI)