cas: 3443-45-6 — see every product listed under this CAS number, including other names
1-Pyrenebutyric acid, 99.91% (CAS 3443-45-6) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 50 g, 25 g, 5 g, 1 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W103047-100 g |
| cas | 3443-45-6 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 3403.31 Pln | |
| MedChemExpress | 50 g | 2168.00 Pln | |
| MedChemExpress | 25 g | 1480.69 Pln | |
| MedChemExpress | 5 g | 533.32 Pln | |
| MedChemExpress | 1 g | 263.96 Pln | |
| MedChemExpress | 10 g | 793.38 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.91% |
4-pyren-1-ylbutanoic acid (CAS 3443-45-6) is a chemical compound with the molecular formula C20H16O2 and a molecular weight of 288.3 g/mol. IUPAC name: 4-pyren-1-ylbutanoic acid. InChIKey: QXYRRCOJHNZVDJ-UHFFFAOYSA-N.
| Molecular formula | C20H16O2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 4-pyren-1-ylbutanoic acid |
| InChIKey | QXYRRCOJHNZVDJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CCCC(=O)O |
Computed by PubChem (NCBI)