cas: 1187931-81-2 — see every product listed under this CAS number, including other names
1-Quinolin-5-yl-methylamine hydrochloride 95% (CAS 1187931-81-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A174764-100mg |
| cas | 1187931-81-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1115.75 Pln | |
| Ambeed | 5g | 3318.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A174764 |
Quinolin-5-ylmethanamine;hydrochloride (CAS 1187931-81-2) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: quinolin-5-ylmethanamine;hydrochloride. InChIKey: LSVBCYBGVYQEJX-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | quinolin-5-ylmethanamine;hydrochloride |
| InChIKey | LSVBCYBGVYQEJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC=NC2=C1)CN.Cl |
Computed by PubChem (NCBI)