cas: 1260794-26-0 — see every product listed under this CAS number, including other names
1-chloroisoquinoline-4-carboxylic acid, 95%+, 95%+ (CAS 1260794-26-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AA0K-50mg |
| cas | 1260794-26-0 |
| size | 50mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 347.60 Pln | |
| Chemat | 250mg | 1374.80 Pln | |
| Chemat | 500mg | 2243.60 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
1-chloroisoquinoline-4-carboxylic acid (CAS 1260794-26-0) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 1-chloroisoquinoline-4-carboxylic acid. InChIKey: VAPWFBQHRVYUDV-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 1-chloroisoquinoline-4-carboxylic acid |
| InChIKey | VAPWFBQHRVYUDV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=C2Cl)C(=O)O |
Computed by PubChem (NCBI)