cas: 187753-13-5 — see every product listed under this CAS number, including other names
1-tert-Butyl 2-methyl 4-hydroxypiperidine-1,2-dicarboxylate, 96% (CAS 187753-13-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222243-100MG |
| cas | 187753-13-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 362.39 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1-O-tert-butyl 2-O-methyl 4-hydroxypiperidine-1,2-dicarboxylate (CAS 187753-13-5) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 4-hydroxypiperidine-1,2-dicarboxylate. InChIKey: RNMVWSAJMIKMDY-UHFFFAOYSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl 4-hydroxypiperidine-1,2-dicarboxylate |
| InChIKey | RNMVWSAJMIKMDY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1C(=O)OC)O |
Computed by PubChem (NCBI)