cas: 187753-13-5 — see every product listed under this CAS number, including other names
1-tert-Butyl 2-methyl 4-hydroxypiperidine-1,2-dicarboxylate, 98%, 98% (CAS 187753-13-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113GH4-25g |
| cas | 187753-13-5 |
| size | 25g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 4288.40 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 1062.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 2-O-methyl 4-hydroxypiperidine-1,2-dicarboxylate (CAS 187753-13-5) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 4-hydroxypiperidine-1,2-dicarboxylate. InChIKey: RNMVWSAJMIKMDY-UHFFFAOYSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl 4-hydroxypiperidine-1,2-dicarboxylate |
| InChIKey | RNMVWSAJMIKMDY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1C(=O)OC)O |
Computed by PubChem (NCBI)