cas: 362706-26-1 — see every product listed under this CAS number, including other names
1-tert-Butyl 2-methyl 4-oxopyrrolidine-1,2-dicarboxylate, 98%, 98% (CAS 362706-26-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CLQH-250mg |
| cas | 362706-26-1 |
| size | 250mg |
| availability | 536g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 146.00 Pln | |
| Chemat | 25g | 256.40 Pln | |
| Chemat | 50g | 434.00 Pln | |
| Chemat | 100g | 750.80 Pln | |
| Chemat | 250g | 1614.80 Pln | |
| Chemat | 500g | 2889.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 2-O-methyl 4-oxopyrrolidine-1,2-dicarboxylate (CAS 362706-26-1) is a chemical compound with the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 4-oxopyrrolidine-1,2-dicarboxylate. InChIKey: UPBHYYJZVWZCOZ-UHFFFAOYSA-N.
| Molecular formula | C11H17NO5 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl 4-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | UPBHYYJZVWZCOZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)CC1C(=O)OC |
Computed by PubChem (NCBI)