cas: 869564-40-9 — see every product listed under this CAS number, including other names
1-tert-Butyl 2-methyl 5-oxopiperidine-1,2-dicarboxylate, 97% (CAS 869564-40-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A804474-10g |
| cas | 869564-40-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 18909.94 Pln | |
| AmBeed | 5g | 15641.92 Pln | |
| Fluorochem | 100mg | 1091.30 Pln | |
| Fluorochem | 250mg | 1434.93 Pln | |
| Fluorochem | 500mg | 2325.24 Pln | |
| Fluorochem | 1g | 3455.05 Pln | |
| Fluorochem | 5g | 10223.50 Pln | |
| Fluorochem | 10g | 17278.31 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-O-tert-butyl 2-O-methyl 5-oxopiperidine-1,2-dicarboxylate (CAS 869564-40-9) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 5-oxopiperidine-1,2-dicarboxylate. InChIKey: UCRLFGKYCFXSEA-UHFFFAOYSA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl 5-oxopiperidine-1,2-dicarboxylate |
| InChIKey | UCRLFGKYCFXSEA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)CCC1C(=O)OC |
Computed by PubChem (NCBI)