CAS 915976-31-7 is the registry number for (S)-1-tert-Butyl 2-methyl 5-oxopiperidine-1,2-dicarboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
1-O-tert-butyl 2-O-methyl (2S)-5-oxopiperidine-1,2-dicarboxylate (CAS 915976-31-7) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-5-oxopiperidine-1,2-dicarboxylate. InChIKey: UCRLFGKYCFXSEA-VIFPVBQESA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-5-oxopiperidine-1,2-dicarboxylate |
| InChIKey | UCRLFGKYCFXSEA-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)CC[C@H]1C(=O)OC |
Computed by PubChem (NCBI)