cas: 897043-85-5 — see every product listed under this CAS number, including other names
1-tert-Butyl 3-ethyl 3-methyl-4-oxopyrrolidine-1,3-dicarboxylate 97% (CAS 897043-85-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A577975-100mg |
| cas | 897043-85-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1538.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A577975 |
1-O-tert-butyl 3-O-ethyl 3-methyl-4-oxopyrrolidine-1,3-dicarboxylate (CAS 897043-85-5) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 3-methyl-4-oxopyrrolidine-1,3-dicarboxylate. InChIKey: YDASEKAEWNKGEJ-UHFFFAOYSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 3-methyl-4-oxopyrrolidine-1,3-dicarboxylate |
| InChIKey | YDASEKAEWNKGEJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CN(CC1=O)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)