cas: 897043-85-5 — see every product listed under this CAS number, including other names
1-tert-butyl 3-ethyl 3-methyl-4-oxopyrrolidine-1,3-dicarboxylate, 97%, 97% (CAS 897043-85-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IFT3-1g |
| cas | 897043-85-5 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 160.40 Pln | |
| Chemat | 25g | 2666.00 Pln | |
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 141.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 3-O-ethyl 3-methyl-4-oxopyrrolidine-1,3-dicarboxylate (CAS 897043-85-5) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 3-methyl-4-oxopyrrolidine-1,3-dicarboxylate. InChIKey: YDASEKAEWNKGEJ-UHFFFAOYSA-N.
| Molecular formula | C13H21NO5 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 3-methyl-4-oxopyrrolidine-1,3-dicarboxylate |
| InChIKey | YDASEKAEWNKGEJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CN(CC1=O)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)