cas: 1016258-69-7 — see every product listed under this CAS number, including other names
1-tert-Butyl 4-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate 97% (CAS 1016258-69-7) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A195083-100g |
| cas | 1016258-69-7 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 14148.69 Pln | |
| Ambeed | 100mg | 186.81 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 1032.31 Pln | |
| Ambeed | 25g | 4469.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A195083 |
1-O-tert-butyl 4-O-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate (CAS 1016258-69-7) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate. InChIKey: UHHUEAGCENEXAJ-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O4 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl 4-(aminomethyl)piperidine-1,4-dicarboxylate |
| InChIKey | UHHUEAGCENEXAJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CCN(CC1)C(=O)OC(C)(C)C)CN |
Computed by PubChem (NCBI)